Atomfair Trifluoroacetic trifluoroacetohydroxamic anhydride C4HF6NO3

Description Trifluoroacetic trifluoroacetohydroxamic anhydride (CAS: 684-78-6) is a highly specialized fluorinated organic compound with the molecular formula C4HF6NO3. This reagent is characterized by its unique structure, combining trifluoroacetyl and hydroxamic anhydride functionalities, making it a valuable intermediate in advanced synthetic chemistry applications. With an IUPAC name of [(2,2,2-trifluoroacetyl)amino] 2,2,2-trifluoroacetate , it is widely recognized for its reactivity and utility in fluorination reactions and as a precursor for bioactive molecules. The compound is supplied as a high-purity reagent, ensuring consistency for research and industrial processes. Proper handling under inert conditions is recommended due to its sensitivity to moisture and potential reactivity.

Description

Trifluoroacetic trifluoroacetohydroxamic anhydride (CAS: 684-78-6) is a highly specialized fluorinated organic compound with the molecular formula C₄HF₆NO₃. This reagent is characterized by its unique structure, combining trifluoroacetyl and hydroxamic anhydride functionalities, making it a valuable intermediate in advanced synthetic chemistry applications. With an IUPAC name of [(2,2,2-trifluoroacetyl)amino] 2,2,2-trifluoroacetate, it is widely recognized for its reactivity and utility in fluorination reactions and as a precursor for bioactive molecules. The compound is supplied as a high-purity reagent, ensuring consistency for research and industrial processes. Proper handling under inert conditions is recommended due to its sensitivity to moisture and potential reactivity.

CAS No: 684-78-6
Molecular Formula: C4HF6NO3
Molecular Weight: 225.05
Exact Mass: 224.98606187
Monoisotopic Mass: 224.98606187
IUPAC Name: [(2,2,2-trifluoroacetyl)amino] 2,2,2-trifluoroacetate
SMILES: C(=O)(C(F)(F)F)NOC(=O)C(F)(F)F
Synonyms: Trifluoroacetic trifluoroacetohydroxamic anhydride, Acetic acid, 2,2,2-trifluoro-, (2,2,2-trifluoroacetyl)azanyl ester, 211-677-9, N,O-Bis(trifluoroacetyl)hydroxylamine, 684-78-6

Application

Trifluoroacetic trifluoroacetohydroxamic anhydride is primarily used as a fluorinating agent and intermediate in the synthesis of pharmaceuticals and agrochemicals. Its reactivity makes it suitable for introducing trifluoroacetyl groups into target molecules, enhancing their metabolic stability. Researchers also employ it in the preparation of hydroxamic acid derivatives for medicinal chemistry studies. Additionally, it serves as a key reagent in the development of advanced materials with tailored fluorinated properties.

If you are interested or have any questions, please contact us at support@atomfair.com