Atomfair (4-Cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid C8H11BN2O3

Description (4-Cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid (CAS No. 1798304-51-4) is a high-purity boronic acid derivative with the molecular formula C8H11BN2O3. This specialized compound features a cyclopropyl and methoxy-substituted pyrimidine core, making it a valuable building block for Suzuki-Miyaura cross-coupling reactions in pharmaceutical and agrochemical research. Its boronic acid functional group enables efficient carbon-carbon bond formation, particularly in the synthesis of complex heterocyclic scaffolds. The product is supplied as a white to off-white crystalline powder with ??95% purity (HPLC), ensuring optimal performance in demanding synthetic applications. Proper storage under inert conditions (2-8??C, argon atmosphere) is recommended to maintain stability.

Description

(4-Cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid (CAS No. 1798304-51-4) is a high-purity boronic acid derivative with the molecular formula C₈H₁₁BN₂O₃. This specialized compound features a cyclopropyl and methoxy-substituted pyrimidine core, making it a valuable building block for Suzuki-Miyaura cross-coupling reactions in pharmaceutical and agrochemical research. Its boronic acid functional group enables efficient carbon-carbon bond formation, particularly in the synthesis of complex heterocyclic scaffolds. The product is supplied as a white to off-white crystalline powder with ??95% purity (HPLC), ensuring optimal performance in demanding synthetic applications. Proper storage under inert conditions (2-8??C, argon atmosphere) is recommended to maintain stability.

CAS No: 1798304-51-4
Molecular Formula: C8H11BN2O3
Molecular Weight: 194.00
Exact Mass: 194.0862724
Monoisotopic Mass: 194.0862724
IUPAC Name: (4-cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid
SMILES: B(C1=C(N=CN=C1OC)C2CC2)(O)O
Synonyms: (4-Cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid, 1798304-51-4, MFCD31556945, (4-Cyclopropyl-6-methoxy-pyrimidin-5-yl)boronic acid, (4-Cyclopropyl-6-methoxypyrimidin-5-yl)boronicacid

Application

This boronic acid derivative serves as a key intermediate in medicinal chemistry for constructing pyrimidine-based drug candidates, particularly kinase inhibitors. It enables the synthesis of novel compounds for oncology and antiviral research through palladium-catalyzed coupling reactions. The cyclopropyl moiety enhances metabolic stability in resulting molecules, making it valuable for lead optimization.

If you are interested or have any questions, please contact us at support@atomfair.com